Zu "220904-83-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GW 5074
Artikelnummer: TGM-T6525-100mg
Description: GW 5074 (Raf1 Kinase Inhibitor I)(IC50=9 nM) is an effective and specific c-Raf inhibitor. It has no effect on the activities of JNK1/2/3, MEK1, MKK6/7, CDK1/2, c-Src, p38 MAP, VEGFR2 or c-Fms. Target: Apoptosis, Raf. Smiles: C(=C1C=2C(NC1=O)=CC=C(I)C2)C3=CC(Br)=C(O)C(Br)=C3. References: Chin PC, et...
| Schlagworte: | Raf1 Kinase Inhibitor I, GW5074 |
| Anwendung: | Raf-1 inhbitor |
| CAS | 220904-83-6 |
| MW: | 520.94 D |
ab 37,00 €
GW 5074
Artikelnummer: Cay10010368-1
Raf-1 is a proto-oncogene serine/threonine protein kinase that signals from Ras to the MAPK/ERK signaling pathway. This pathway mediates basic cellular functions, including proliferation, differentiation, and survival. GW 5074 is a potent, selective, and cell-permeable inhibitor of Raf-1 (IC50 = 9 nM). It blocks...
| Schlagworte: | 3-[(3,5-dibromo-4-hydroxyphenyl)methylene]-1,3-dihydro-5-iodo-2H-indol-2-one |
| Anwendung: | Raf-1 inhbitor |
| CAS | 220904-83-6 |
| MW: | 520.9 D |
ab 52,00 €
GW5074
Artikelnummer: LKT-G8850.1
A potent, selective and cell-permeable c-Raf1 kinase inhibitor.
| Schlagworte: | 3-(3,5-Dibromo-4-hydroxybenzyliden)-5-iodo-1,3-dihydroindol-2-one,... |
| Anwendung: | c-Raf1 kinase inhibitor |
| CAS | 220904-83-6 |
| MW: | 520.94 D |
ab 120,00 €
