Zu "220201-34-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Talaporfin (sodium salt)
Artikelnummer: Cay35722-10
Talaporfin is a photosensitizer. It induces apoptosis, DNA double-strand breaks (DSBs), and the production of reactive oxygen species (ROS) in TE-11R 5-fluorouracil-resistant esophageal squamous cell carcinoma (ESCC) cells when used at a concentration of 30 µg/ml in combination with radiation. Talaporfin (2.5, 5,...
| Schlagworte: | Mono-L-aspartyl Chlorin e6, NPe6, Taporfin,... |
| Anwendung: | Photosensitizer |
| CAS | 220201-34-3 |
| MW: | 799.7 D |
ab 133,00 €
Talaporfin sodium
Artikelnummer: TGM-T16978-25mg
Description: Talaporfin is a photosensitizer used in photodynamic therapy. Target: Others. Smiles: [Na].CCc1c(C)c2cc3[nH]c(cc4nc([C@@H](CCC(O)=O)[C@@H]4C)c(CC(=O)N[C@@H](CC(O)=O)C(O)=O)c4[nH]c(cc1n2)c(C)c4C(O)=O)c(C)c3C=C , w:23.23,11.10,7.5,39.38, . References:...
| Schlagworte: | ME2906, NPe6, Mono-L-aspartyl chlorin e6 |
| Anwendung: | Antineoplastic, Photosensitizer |
| CAS | 220201-34-3 |
| MW: | 734.762 D |
1.659,00 €
