Zu "2170137-61-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
GSK3685032
Artikelnummer: Cay44360-1
GSK3685032 is an inhibitor of DNA methyltransferase 1 (DMNT1, IC50 = 0.23 µM). It is selective for DMNT1 over DMNT3A/3L and DMNT3B/3L and a panel of 34 methyltransferases and 369 kinases (IC50s = >10 µM for all). GSK3685032 inhibits the proliferation of 51 hematological cancer cell lines (median IC50 = 0.64 µM). It...
| Schlagworte: | alpha-[[6-(4-amino-1-piperidinyl)-3,5-dicyano-4-ethyl-2-pyridinyl]thio]-benzeneacetamide |
| Anwendung: | DNMT1 inhibitor |
| CAS | 2170137-61-6 |
| MW: | 420,54 D |
ab 112,00 €
GSK3685032
Artikelnummer: TGM-T9573-100mg
Description: GSK3685032 is a non-covalent and selective DNMT1 inhibitor(IC50 = 36 nM). The inhibitory effect is time-independent and reversible. GSK3685032 induces loss of DNA methylation and transcriptional activation and inhibits cancer cell growth. Target: DNA Methyltransferase. Smiles:...
| CAS | 2170137-61-6 |
| MW: | 420.53 D |
ab 73,00 €
GSK3685032
Artikelnummer: LKT-G733404.1
GSK3685032 is an inhibitor of DNA methyltransferase 1. SMILES: CCC1=C(C(=NC(=C1C#N)SC(C2=CC=CC=C2)C(=O)N)N3CCC(CC3)N)C#N
| Schlagworte: | GSK-3685032, 2-[6-(4-aminopiperidin-1-yl)-3,5-dicyano-4-ethylpyridin-2-yl]sulfanyl-2-phenylacetamide |
| Anwendung: | Reversible DNMT1-selective inhibitor |
| CAS | 2170137-61-6 |
| MW: | 420.54 D |
ab 85,00 €
