Zu "21618-91-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5-(3'-Hydroxyphenyl)-gamma-Valerolactone
Artikelnummer: TGM-T83804-100mg
Description: 5-(3'-Hydroxyphenyl)-gamma-valerolactone, a metabolite resulting from the transformation of polyphenols such as (+)-catechin and (-)-epicatechin by gut microbiota, plays a significant role in biological processes. Target: Others. Smiles: OC1=CC=CC(CC2CCC(O2)=O)=C1
| Schlagworte: | delta-(3'-Hydroxyphenyl)-gamma-VL, (3'-hydroxy)-PVL, delta-(3'-Hydroxyphenyl)-gamma-Valerolactone,... |
| CAS | 21618-91-7 |
| MW: | 192.21 D |
ab 156,00 €
5-(3'-Hydroxyphenyl)-gamma-Valerolactone
Artikelnummer: Cay38519-10
5-(3'-Hydroxyphenyl)-gamma-valerolactone is a metabolite of various polyphenols, including (+)-catechin (Cay-70940) and (-)-epicatechin (Cay-11807). It is formed from these polyphenols by gut microbiota.Formal Name: dihydro-5-[(3-hydroxyphenyl)methyl]-2(3H)-furanone. CAS Number: 21618-91-7. Synonyms:...
| Schlagworte: | (3'-hydroxy)-PVL, 5-(3'-Hydroxyphenyl)-gamma-VL, delta-(3'-Hydroxyphenyl)-gamma-Valerolactone,... |
| Anwendung: | Various polyphenol metabolite |
| CAS | 21618-91-7 |
| MW: | 192.2 D |
ab 69,00 €
