Zu "2160546-07-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
IACS-13909
Artikelnummer: TGM-T9196-100mg
Description: IACS-13909 (BBP-398), a specific and potent allosteric inhibitor of SHP2, that suppresses signaling through the MAPK pathway. Target: Phosphatase. Smiles: CC1(N)CCN(CC1)c1cnc2c(n[nH]c2n1)-c1cccc(Cl)c1Cl. References: Yuting Sun, et al. Allosteric SHP2 Inhibitor, IACS-13909, Overcomes EGFR-Dependent and...
| Schlagworte: | BBP-398, BBP-398 |
| Anwendung: | Allosteric SHP-2 inhibitor |
| CAS | 2160546-07-4 |
| MW: | 377.27 D |
ab 97,00 €
IACS-13909
Artikelnummer: Cay40654-10
IACS-13909 is an allosteric inhibitor of Src homology region 2 domain-containing phosphatase 2 (SHP-2, IC50 = 11 nM). It binds wild-type SHP-2 and SHP-2 containing a constitutively activating glutamate-to-lysine substitution at position 76 (SHP-2E76K, Kds = 49 and 211 nM, respectively). IACS-13909 decreases the...
| Schlagworte: | 1-[3-(2,3-dichlorophenyl)-1H-pyrazolo[3,4-b]pyrazin-6-yl]-4-methyl-4-piperidinamine |
| Anwendung: | Allosteric SHP-2 inhibitor |
| CAS | 2160546-07-4 |
| MW: | 377.3 D |
ab 212,00 €
