Zu "21411-53-0" wurden 5 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Virginiamycin Mixture
Artikelnummer: LKT-V3327.100
Virginiamycin Mixture is a mixture of virginiamycin M 1 and virginiamycin S1. Virginiamycin is a macrolide antibiotic commonly used in livestock as a growth promoter, it is also occasionally used to prevent microbial contamination in ethanol fuels. Virginiamycin is an antibacterial that binds 23S rRNA of the...
| Schlagworte: | Virginiamycin M1 and S1 mixture |
| Anwendung: | Macrolide antibiotic |
| CAS | 21411-53-0 |
| MW: | 525/823 D |
ab 96,00 €
Virginiamycin M1
Artikelnummer: TGM-T13303-100mg
Description: Virginiamycin M1 (Pristinamycin IIA) is a macrocyclic lactone peptide antibiotic and is a member of the streptogramin A group of antibiotics. Target: Antibacterial. Smiles: CC(C)[C@H]1OC(=O)C2=CCCN2C(=O)c2coc(CC(=O)C[C@H](O)\C=C(/C)\C=C\CNC(=O)\C=C\[C@H]1C)n2. References: Sezonov G, et al. Complete...
| Schlagworte: | Ostreogrycin A, Pristinamycin IIA |
| CAS | 21411-53-0 |
| MW: | 525.59 D |
ab 65,00 €
Virginiamycin M1
Artikelnummer: Cay9002172-25
Virginiamycin M1 is a macrolide antibiotic. It is a member of the streptogramin A group of antibiotics, which bind the 50S ribosomal subunit at the peptidyl transferase center to inhibit initiation and translocation. They show good bactericidal activity against methicillin-resistant S. aureus (MRSA), although...
| Schlagworte: | Mikamycin A, NSC 244426, NSC 87432, Ostreogrycin A, Pristinamycin IIA, RP 12536, Streptogramin A,... |
| Anwendung: | Synergistic bacterial protein synthesis inhibitor |
| CAS | 21411-53-0 |
| MW: | 525.6 D |
ab 431,00 €
Virginiamycin M1
Artikelnummer: LKT-V3325.1
Macrolide antibiotic, peptidyl transferase inhibitor, protein translation inhibitor.
| Schlagworte: | Mikamycin A, Staphilomycin, Ostreogrycin A, Virginiamycin M1, Pristinamycin IIA |
| Anwendung: | Macrolide antibiotic, peptidyl transferase inhibitor, protein translation inhibitor |
| CAS | 21411-53-0 |
| MW: | 525.59 D |
ab 58,00 €
Ostreogrycin A (Mikamycin A, Pristinamycin IIA, Stephylo
Artikelnummer: O8070-50.5
Ostreogrycin A also commonly referred to as virginiamycin M1 or streptogramin A is the major component of the "virginamycin complex". In the 1950s this complex was independently discovered so many times the literature became highly confusing. Ostreogrycin A is a macrocyclic lactone antibiotic that acts...
| CAS | 21411-53-0 |
| MW: | 525.60 D |
573,00 €
