Zu "214047-00-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Matrixyl
Artikelnummer: TGM-T21250-5mg
Description: Matrixyl (PAL-Lys-Thr-Thr-Lys-Ser) is a matrikine used in anti-wrinkle cosmetics. Target: Others. Smiles: CCCCCCCCCC CCCCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(O)=O. References: Giangreco F, Höfinger S, Bakalis E, Zerbetto F. Impact of...
| Schlagworte: | Palmitoyl-KTTKS, Pal-Lys-Thr-Thr-Lys-Ser-OH, PAL-Lys-Thr-Thr-Lys-Ser, Palmitoyl pentapeptide |
| CAS | 214047-00-4 |
| MW: | 802.05 D |
48,00 €
Palmitoyl Pentapeptide-4
Artikelnummer: CSB-DT1698.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Pal-Lys-Thr-Thr-Lys-Ser, Pal-KTTKS |
| Anwendung: | Cosmetic peptide |
| CAS | 214047-00-4 |
| MW: | 802.065 D |
229,00 €
