Zu "2140-79-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
2'-O-Methyladenosine
Artikelnummer: TGM-T13482-100mg
Description: 2'-O-Methyladenosine, a methylated adenine residue, is present in the urine of both normal individuals and patients with adenosine deaminase deficiency, and exhibits unique hypotensive activities. Target: Endogenous Metabolite. Smiles: CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc12. References:...
| CAS | 2140-79-6 |
| MW: | 281.27 D |
ab 31,00 €
2'-O-Methyladenosine
Artikelnummer: Cay16936-10
2'-O-Methyladenosine is an analog of adenosine used to prepare nucleoside derivatives as inhibitors of viral RNA translation and replication.Formal Name: 2'-O-methyl-adenosine. CAS Number: 2140-79-6. Molecular Formula: C11H15N5O4. Formula Weight: 281.3. Purity: >98%. Formulation: (Request formulation change), A...
| Schlagworte: | 2'-O-methyl-adenosine |
| Anwendung: | Adenosine analog |
| CAS | 2140-79-6 |
| MW: | 281.3 D |
ab 44,00 €
