Zu "213261-59-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RITA
Artikelnummer: Cay10006426-1
HDM-2 (human double minute-2, MDM-2 in mouse) is a key negative regulator of p53 that binds to and targets p53 for proteasomal degradation. Overexpression of HDM-2 in some tumors leads to inactivation of p53 thereby allowing tumor cells to escape p53-induced apoptosis. RITA is an inhibitor of the protein-protein...
| Schlagworte: | 2,5-bis(5-hydroxymethyl-2-thienyl) Furan, NSC 652287, 5,5'-(2,5-furandiyl)bis-2-thiophenemethanol |
| Anwendung: | p53-HDM-2 interaction inhibitor |
| CAS | 213261-59-7 |
| MW: | 292.4 D |
ab 96,00 €
RITA
Artikelnummer: LKT-R3476.1
p53 activator.
| Schlagworte: | Reactivation of p53 and induction of tumor cell apoptosis |
| Anwendung: | p53 activator |
| CAS | 213261-59-7 |
| MW: | 292.37 D |
ab 136,00 €
RITA
Artikelnummer: TGM-T1798-100mg
Description: RITA (NSC-652287)(NSC-652287) induced cross-links of both DNA-DNA and DNA-protein with no detectable DNA single-strand breaks. RITA, like nutlin-3, can disrupt the p53/Mdm2 interaction. Target: p53, Autophagy, Mdm2, DNA Alkylator/Crosslinker. Smiles: OCc1ccc(s1)-c1ccc(o1)-c1ccc(CO)s1. References:...
| Schlagworte: | NSC 652287, RITA (NSC 652287) |
| CAS | 213261-59-7 |
| MW: | 292.37 D |
ab 30,00 €
