Zu "21306-65-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TPh A
Artikelnummer: AG-CR1-3507-M001
White solid. Soluble in DMSO. Nuclear protein pirin inhibitor, Inhibits the interaction between Bcl3 oncoprotein and the nuclear protein pirin, Melanoma cell migration inhibitor.
| Schlagworte: | Triphenyl Compound A, 4-Methyl-N-(methyl(4-(phenylmethoxy) phenyl)-lambda4-sulfanylidene-benzene-sulfonamide,... |
| Anwendung: | Pirin inhibitor |
| CAS | 21306-65-0 |
| MW: | 399,5 D |
ab 39,00 €
TPh A
Artikelnummer: TGM-T39578-1mg
Description: TPh A (Triphenyl Compound A) is an inhibitor of the nuclear protein pirin (Ki: 0.6 uM), a protein that can be used as a bioprobe to regulate pirin-related functions. Target: Others. Smiles: Cc1ccc(cc1)S(=O)(=O)\N=S(/C)c1ccc(OCc2ccccc2)cc1. References: Isao Miyazaki, et al. A Small-Molecule Inhibitor...
| Schlagworte: | Triphenyl Compound A |
| Anwendung: | Pirin inhibitor |
| CAS | 21306-65-0 |
| MW: | 399.53 D |
47,00 €
