Zu "212631-67-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PD 184161
Artikelnummer: Cay10012431-5
The mitogen-activated protein (MAP) kinase intracellular signaling pathways are involved in the regulation of various cellular functions. One of these pathways, the Raf/MEK/ERK pathway, plays a major role in the regulation of cellular growth, differentiation, and proliferation. The modulation of this cascade has...
| Schlagworte: | 5-bromo-2-[(2-chloro-4-iodophenyl)amino]-N-(cyclopropylmethoxy)-3,4-difluoro-benzamide |
| Anwendung: | MEK1 inhibitor, MEK2 inhibitor |
| CAS | 212631-67-9 |
| MW: | 557.6 D |
ab 42,00 €
PD184161
Artikelnummer: TGM-T21635-100mg
Description: PD184161 is a novel, orally-active MEK inhibitor. PD184161 inhibited MEK activity (IC50 = 10-100 nM) in a time- and concentration-dependent manner[1]. Target: MEK. Smiles: Fc1c(F)c(Nc2ccc(I)cc2Cl)c(cc1Br)C(=O)NOCC1CC1. References: Klein, P. J.,Schmidt, C.M.,Wiesenauer, C.A., et al. The effects of a...
| CAS | 212631-67-9 |
| MW: | 557.56 D |
ab 31,00 €
