Zu "211915-06-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dabigatran etexilate
Artikelnummer: Cay17131-10
Dabigatran etexilate is a prodrug form of the thrombin inhibitor dabigatran (Cay-17133). It inhibits thrombin-induced platelet aggregation in isolated rabbit platelets (IC50 = 0.337 µM) and inhibits thrombus formation in a rat model of venous thrombosis (ED50 = 7.8 µmol/kg). Formulations containing dabigatran...
| Schlagworte: | BIBR 1048,... |
| Anwendung: | Thrombin inhibitor prodrug |
| CAS | 211915-06-9 |
| MW: | 627.7 D |
ab 73,00 €
Dabigatran etexilate
Artikelnummer: TGM-T0389-2mg
Description: Dabigatran etexilate (BIBR 1048) is a thrombin inhibitor that binds to thrombin, blocking its thrombogenic activity and preventing thrombus formation. Target: Thrombin. Smiles: CCCCCCOC(=O)N\N=C\c1ccc(NCc2nc3cc(ccc3n2C)C(=O)N(CCC(=O)OCC)c2ccccn2)cc1. References: Wienen W, et al. Thromb Haemost, 2007,...
| Schlagworte: | BIBR 1048 |
| CAS | 211915-06-9 |
| MW: | 627.73 D |
ab 30,00 €
