Zu "2101981-60-4" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(R)-DOTMA (chloride)
Artikelnummer: Cay45535-10
(R)-DOTMA is a cationic lipid that has been used in the formation of liposomes with a net cationic charge. (R)-DOTMA-containing liposomes have been complexed with mRNA to form RNA-lipoplexes (RNA-LPXs). SMILES: C[N+](C)(C)C[C@@H](OCCCCCCCC/C=C\CCCCCCCC)COCCCCCCCC/C=C\CCCCCCCC.[Cl-]. InChi Code:...
| Schlagworte: | (2R)-N,N,N-trimethyl-2,3-bis[(9Z)-9-octadecen-1yloxy]-1-propanaminium, monochloride |
| Anwendung: | Cationic lipid, liposome formation |
| CAS | 2101981-60-4 |
| MW: | 670.59 D |
ab 91,00 €
