Zu "21018-84-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AMAROGENTIN
Artikelnummer: TGM-T5497-100mg
Description: Amarogentin is mainly extracted from Swertia and Gentiana roots. It plays cemopreventive/therapeutic role during liver carcinogenesis through modulation of cell cycle and apoptosis. Target: AMPK, Apoptosis. Smiles: OCC1OC(OC2OC=C3C(CCOC3=O)C2C=C)C(OC(=O)c2c(O)cc(O)cc2-c2cccc(O)c2)C(O)C1O. References:...
| CAS | 21018-84-8 |
| MW: | 586.54 D |
ab 34,00 €
Amarogentin
Artikelnummer: Cay24914-25
Amarogentin is a secoiridoid glycoside that has been found in Swertia and has diverse biological activities, including anticancer, antidiabetic, and anti-leishmanial properties. It inhibits the growth of SNU-16 human gastric cancer cells (IC50 = 12.4 µM after 48 hours) and increases apoptosis when used at a...
| Schlagworte: | 5-ethenyl-4,4aS,5R,6S-tetrahydro-6-[[2-O-[(3,3',5-trihydroxy[1,1'-biphenyl]-2-yl)carbonyl]-beta-D-glucopyranosyl]oxy]-1H,3... |
| Anwendung: | Bioactive secoiridoid glycoside |
| CAS | 21018-84-8 |
| MW: | 586.5 D |
ab 44,00 €
