Zu "2098488-36-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Azido-Thalidomide
Artikelnummer: Cay26146-50
Azido-thalidomide is a building block in the synthesis of proteolysis-targeting chimera (PROTAC) technologies. It contains thalidomide, which is a ligand for the E3 ubiquitin ligase cereblon, and can be conjugated to alkynylated ligands for target proteins via click chemistry. Azido-thalidomide has been used in the...
| Schlagworte: | N-(4-azidobutyl)-2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]-acetamide |
| Anwendung: | Building block, PROTAC, cereblon ligand, click chemistry |
| CAS | 2098488-36-7 |
| MW: | 428.4 D |
ab 93,00 €
Thalidomide-O-amido-C4-N3
Artikelnummer: TGM-T15189-10mg
Description: Thalidomide-O-amido-C4-N3 (Cereblon Ligand-Linker Conjugates 4) is an E3 ligase ligand-linker conjugate incorporating the Thalidomide-based cereblon ligand and a linker. Target: Ligand for E3 Ligase, Others. Smiles: O=C1C=2C(C(=O)N1C3C(=O)NC(=O)CC3)=CC=CC2OCC(NCCCCN=[N+]=[N-])=O. References: Schiedel...
| Schlagworte: | Cereblon Ligand-Linker Conjugates 4, E3 ligase Ligand-Linker Conjugates 18 |
| Anwendung: | Building block, PROTAC, cereblon ligand, click chemistry |
| CAS | 2098488-36-7 |
| MW: | 428.4 D |
ab 48,00 €
