Zu "2089251-57-8" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Lipid M
Lipid M

Artikelnummer: TGM-T73990-50mg

Description: Lipid M (pKa: 6.75) is a potential carrier for mRNA vaccines, offering enhanced immune responses and increased tolerability [1]. Target: Others. Smiles: CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCOC(=O)C(CCCCCCCC)CCCCCCCC
CAS 2089251-57-8
MW: 710.17 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten
Lipid M
Lipid M

Artikelnummer: Cay38775-1

Lipid M is an ionizable cationic lipid (pKa = 6.75) that has been used in the generation of lipid nanoparticles (LNPs) for mRNA delivery in vivo. LNPs containing lipid M and encapsulating mRNA encoding influenza virus genes increase anti-influenza virus IgG titers in cynomolgus monkeys without inducing local edema,...
Schlagworte: 2-octyl-decanoic acid, 7-[(2-hydroxyethyl)[8-(nonyloxy)-8-oxooctyl]amino]heptyl ester
Anwendung: Ionizable cationic lipid, LNP formation
CAS 2089251-57-8
MW: 710.2 D
ab 138,00 €
Bewerten