Zu "2088135-12-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR 16832
Artikelnummer: Cay27632-5
SR 16832 is a dual-site covalent antagonist of peroxisome proliferator-activated receptor gamma (PPARgamma). It inhibits MRL20-induced allosteric activation of PPARgamma in a reporter assay using HEK293T cells when used at a concentration of 5 µM. SR 16832 also reduces basal activity of PPARgamma and inhibits...
| Schlagworte: | 2-chloro-N-(6-methoxy-4-quinolinyl)-5-nitro-benzamide |
| Anwendung: | Dual-site covalent PPARgamma antagonist |
| CAS | 2088135-12-8 |
| MW: | 357.7 D |
ab 57,00 €
SR 16832
Artikelnummer: TGM-T24827-100mg
Description: SR 16832 is a dual-site PPARgamma inhibitor. It also inhibits the binding of endogenous ligands and transcriptional activity of PPARgamma, more effectively than the orthosteric covalent antagonist GW 9662 and T 0070907. Target: PPAR. Smiles: N(C(=O)C1=CC(N(=O)=O)=CC=C1Cl)C=2C3=C(C=CC(OC)=C3)N=CC2
| Schlagworte: | SR-16832 , SR16832 |
| Anwendung: | Dual-site covalent PPARgamma antagonist |
| CAS | 2088135-12-8 |
| MW: | 357.75 D |
ab 37,00 €
