Zu "20846-91-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(S,S)-Ethylenediamine-N,N'-disuccinic acid
Artikelnummer: CDX-E0096-G025
Aminopolycarboxylic acid (APCA). A powerful, readily biodegradable chelant. Complexing agent, exhibiting superior biological degradation (environmentally friendly) compared to EDTA. Used in cosmetic formulations, as effective anti-oxidant and water hardness control, to reduce radical generation, as effective...
| Schlagworte: | EDDS, Ethylenediamine disuccinate, (S,S)-Ethylenediaminedisuccinic acid, N,N'-1,2-Ethanediylbis-L-aspartic acid |
| Anwendung: | Biodegradable chelant, Complexing agent |
| CAS | 20846-91-7 |
| MW: | 292.24 D |
ab 153,00 €
N,N'-Ethylenediamine disuccinic acid
Artikelnummer: TGM-T33558-100mg
Description: N, N'-Ethylenediamine disuccinic acid, as an aminopolycarboxylic acid, can be used as a biodegradable chelating agent similar to EDTA and used on a large scale in numerous applications. Target: Others. Smiles: OC(=O)C[C@H](NCCN[C@@H](CC(O)=O)C(O)=O)C(O)=O. References: Zhou LY, Chen S, Li H, Guo S, Liu...
| Schlagworte: | EDDS, EDSS, L-Ethylenediaminedisuccinic acid |
| CAS | 20846-91-7 |
| MW: | 292.24 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
