Zu "2055536-64-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cintirorgon
Artikelnummer: TGM-TQ0007-100mg
Description: Cintirorgon (LYC-55716) is a selective, oral agonist of RORgamma, modulating gene expression in RORgamma-expressing T lymphocyte immune cells. Target: ROR. Smiles: CC(C)(C[C@H]1CN(c2cc(ccc2O1)-c1cc(F)cc(OC(F)F)c1)S(=O)(=O)c1cccc(c1)C(F)(F)F)C(O)=O. References: Lycera Announces Initiation of Phase 1/2a...
| Schlagworte: | LYC-55716 |
| Anwendung: | RORgamma agonist |
| CAS | 2055536-64-4 |
| MW: | 603.53 D |
ab 77,00 €
Cintirorgon
Artikelnummer: Cay28425-1
Cintirorgon is a retinoic acid receptor-related orphan receptor ? (ROR?) agonist with EC50 values of less than 0.5 µM in a reporter assay and time-resolved FRET (TR-FRET) assay.Formal Name:...
| Schlagworte: | LYC-55716,... |
| Anwendung: | RORgamma agonist |
| CAS | 2055536-64-4 |
| MW: | 603.5 D |
ab 90,00 €
