Zu "205445-51-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Boc-D-Phe(3,4-DiF)-OH
Artikelnummer: TGM-T65467-50mg
Description: Boc-D-Phe(3,4-DiF)-OH, an amino acid derivative, has extensive applications in life science-related research. Smiles: CC(C)(C)OC(=O)N[C@H](Cc1ccc(F)c(F)c1)C(O)=O
| CAS | 205445-51-8 |
| MW: | 301.29 D |
33,00 €
Boc-D-3,4-Difluorophe
Artikelnummer: CSB-DT3098.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| Anwendung: | Peptide synthesis |
| CAS | 205445-51-8 |
| MW: | 301.289 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
