Zu "203120-46-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Laninamivir octanoate
Artikelnummer: TGM-T9124-100mg
Description: Laninamivir octanoate (CS-8958) is a long acting influenza neuraminidase (NA) inhibitor which shows superior anti-influenza virus activity. Target: Influenza Virus. Smiles: [H][C@]1(OC(=C[C@H](NC(N)=N)[C@H]1NC(C)=O)C(O)=O)[C@H](OC)[C@H](O)COC(=O)CCCCCCC. References: Yamashita M . CS-8958, a Prodrug of...
| Schlagworte: | CS-8958 |
| Anwendung: | Influenza neuraminidase inhibitor, laninamivir prodrug |
| CAS | 203120-46-1 |
| MW: | 472.53 D |
ab 40,00 €
Laninamivir octanoate
Artikelnummer: Cay40850-10
Laninamivir octanoate is an inhibitor of influenza neuraminidases and a prodrug form of laninamivir. It selectively inhibits the neuraminidases from influenza A H1N1, H2N2, and H3N2 strains (mean IC50s = 822, 128, and 114 nM, respectively) over the neuraminidases from influenza B Victoria and Yamagata strains (mean...
| Schlagworte: | CS 8958,... |
| Anwendung: | Influenza neuraminidase inhibitor, laninamivir prodrug |
| CAS | 203120-46-1 |
| MW: | 472.5 D |
ab 90,00 €
