Zu "203115-63-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NSC 617145
Artikelnummer: TGM-T9168-100mg
Description: NSC 617145 (NSC617145) is an inhibitor of WRN helicase that inhibits the ATPase, but not exonuclease, activity of WRN helicase in a concentration-dependent manner. Target: DNA/RNA Synthesis. Smiles: CC(C)(CN1C(=O)C(Cl)=C(Cl)C1=O)CN1C(=O)C(Cl)=C(Cl)C1=O. References: Aggarwal, M., Banerjee, T., Sommers,...
| Schlagworte: | NSC617145, NSC-617145 |
| Anwendung: | WRN inhibitor |
| CAS | 203115-63-3 |
| MW: | 400.04 D |
ab 31,00 €
NSC 617145
Artikelnummer: Cay21973-1
NSC 617145 is an inhibitor of WRN helicase (IC50 = 230 nM) that inhibits the ATPase, but not exonuclease, activity of WRN helicase in a concentration-dependent manner. It is selective for WRN over BLM, FANCJ, ChlR1, RecQ, and UvrD helicases, only exhibiting 7% inhibition of RECQ1 at a concentration of 5 µM. NSC...
| Schlagworte: | 1,1'-(2,2-dimethyl-1,3-propanediyl)bis[3,4-dichloro-1H-pyrrole-2,5-dione |
| Anwendung: | WRN inhibitor |
| CAS | 203115-63-3 |
| MW: | 400 D |
ab 47,00 €
