Zu "2021255-73-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Phenylephrine Glucuronide
Artikelnummer: Cay26647-1
Phenylephrine glucuronide is a metabolite of the alpha1A-adrenergic receptor agonist phenylephrine (Cay-18619, Cay-17205).Formal Name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-((R)-1-hydroxy-2-(methylamino)ethyl)phenoxy)tetrahydro-2H-pyran-2-carboxylic acid. CAS Number: 2021255-73-0. Molecular Formula: C15H21NO8....
| Schlagworte: | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3-((R)-1-hydroxy-2-(methylamino)ethyl)phenoxy)tetrahydro-2H-pyran-2-carboxylic acid |
| Anwendung: | Phenylephrine metabolite |
| CAS | 2021255-73-0 |
| MW: | 343.3 D |
742,00 €
Phenylephrine Glucuronide
Artikelnummer: TGM-T85248-10mg
Description: Phenylephrine glucuronide, a metabolite of phenylephrine (an alpha1A-adrenergic receptor agonist), is produced through metabolic processes. Target: Others. Smiles: CNC[C@H](O)c1cccc(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)c1
| CAS | 2021255-73-0 |
| MW: | 343.332 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
