Zu "197855-65-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Z-FA-FMK
Artikelnummer: Cay14462-1
Z-FA-FMK is an irreversible inhibitor of cysteine proteases, including cathepsins B, L, and S, cruzain, and papain. It also inhibits effector caspases-2, -3, -6, and -7 (IC50 = 6-32 µM) without affecting the initiator caspases-8 and -10. Z-FA-FMK also modulates infection by certain bacteria, parasites, and viruses....
| Schlagworte: | Z-Phe-Ala-Fluoromethyl Ketone, N-[(1S)-2-[(3-fluoro-1-methyl-2-oxopropyl)amino]-2-oxo-1-(phenylmethyl)ethyl]-carbamic... |
| Anwendung: | Cysteine protease inhibitor |
| CAS | 197855-65-5 |
| MW: | 386.4 D |
ab 114,00 €
Z-FA-FMK
Artikelnummer: TGM-T6738-100mg
Description: Z-FA-FMK can irreversibly inhibit cysteine protease and also inhibit effector caspases. Target: SARS-CoV, Cysteine Protease. Smiles: CC(NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)CF. References: Rasnick D. Anal Biochem. 1985, 149(2), 461-465.
| CAS | 197855-65-5 |
| MW: | 386.42 D |
ab 57,00 €
