Zu "19685-09-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(S)-10-hydroxy-Camptothecin
Artikelnummer: Cay14635-25
DNA topoisomerases relax supercoiled DNA during replication, transcription, recombination, repair, and chromosome condensation. The relaxation of DNA supercoiling by topoisomerase I at single-strand breaks represents a target for anticancer agents to intercalate between DNA base pairs, leading to the activation of...
| Schlagworte: | ChEMBL 273862, NSC 107124, (4S)-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
| Anwendung: | Topoisomerase I inhibitor |
| CAS | 19685-09-7 |
| MW: | 364.4 D |
ab 85,00 €
(S)-10-Hydroxycamptothecin
Artikelnummer: TGM-T2764-100mg
Description: (S)-10-Hydroxycamptothecin (10-HCPT) is a DNA topoisomerase I inhibitor used as a clinical therapeutic agent against hepatoma. Target: Apoptosis, Topoisomerase. Smiles: O=C1N2C(C=3C(C2)=CC=4C(N3)=CC=C(O)C4)=CC5=C1COC(=O)[C@@]5(CC)O. References: Ling YH, et al. Cancer Biochem Biophys, 1990, 11(1), 23-30.
| Schlagworte: | 10-Hydroxycamptothecin, 10-HCPT |
| Anwendung: | Topoisomerase I inhibitor |
| CAS | 19685-09-7 |
| MW: | 364.35 D |
ab 42,00 €
