Zu "1968-05-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
3,3'-Diindolylmethane
Artikelnummer: TGM-T2991-100mg
Description: 3,3'-Diindolylmethane (DIM), a small molecule compound, is a proposed Y preventive agent. Target: Androgen Receptor, Autophagy. Smiles: C(C1=CNC2=C1C=CC=C2)C1=CNC2=C1C=CC=C2. References: Saijun Fan, et al. PNAS. 2013, 110(46):18650-18655.
| Schlagworte: | DIM, HB 236, Arundine |
| CAS | 1968-05-4 |
| MW: | 246.31 D |
ab 40,00 €
3,3'-Diindolylmethane
Artikelnummer: Cay15927-500
3,3'-Diindolylmethane (DIM) is a bioactive metabolite of indole-3-carbinol, a phytochemical produced by the breakdown of the glucosinolate glucobrassicin found in cruciferous vegetables. At 10-30 µM, it demonstrates anticancer and chemopreventative effects involving Nrf2 induction of Phase 2 enzymes, promotion of...
| Schlagworte: | DIM, 3,3'-methylenebis-1H-indole |
| Anwendung: | Chemopreventative anticancer compound |
| CAS | 1968-05-4 |
| MW: | 246.3 D |
ab 44,00 €
3,3'-Diindolylmethane
Artikelnummer: LKT-D3232.5
Indole found in cruciferous vegetables, AhR agonist.
| Schlagworte: | 3,3'-Diindolymethane, 3,3'-Methylenebis-1H-indole, DIM |
| Anwendung: | Apoptosis inducer |
| CAS | 1968-05-4 |
| MW: | 246,31 D |
ab 70,00 €
