Zu "195207-78-4" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5'-Iodo-2',5'-dideoxy-thymidine 3'-CE Phosphoramidite
Artikelnummer: Cay44585-10
5'-Iodo-2',5'-dideoxy-thymidine 3'-CE phosphoramidite is a nucleoside building block that has been used in the synthesis of ssDNA and cyclized ssDNA.. SMILES: O=C1N(C=C(C(N1)=O)C)[C@H]2C[C@@H]([C@H](O2)CI)OP(OCCC#N)N(C(C)C)C(C)C. InChi Code:...
| Schlagworte: | 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite]5'-deoxy-5'-iodo-thymidine |
| Anwendung: | Nucleoside building block |
| CAS | 195207-78-4 |
| MW: | 552.3 D |
ab 49,00 €
