Zu "194918-76-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ACPT-I
Artikelnummer: TGM-T22549-10mg
Description: Agonist for group III mGlu receptors. Target: Others. Smiles: C(O)(=O)[C@@]1(N)C[C@@H](C(O)=O)[C@@H](C(O)=O)C1
| Anwendung: | mGluR4a / mGluR8 agonist |
| CAS | 194918-76-8 |
| MW: | 217.18 D |
ab 150,00 €
ACPT-I
Artikelnummer: Cay78010-1
ACPT-I is an agonist of the group III metabotropic glutamate receptors (mGluRs) mGluR4a and mGluR8 (EC50s = 7.2 and 8.2 µM, respectively) that has no effect on mGluR1a or mGluR2. It has diverse biological activity, including neuroprotective, anticonvulsant, and anxiolytic-like effects. ACPT-I (1-200 µM) reduces cell...
| Schlagworte: | (4beta)--amino-1alpha,2alpha,4-cyclopentanetricarboxylic acid |
| Anwendung: | mGluR4a / mGluR8 agonist |
| CAS | 194918-76-8 |
| MW: | 217.2 D |
ab 69,00 €
