Zu "193000-39-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ZM 323881 (hydrochloride)
Artikelnummer: Cay21347-1
ZM 323881 is a potent inhibitor of vascular endothelial growth factor receptor 2 (VEGFR2, IC50 = 50 = 8 nM) but not basal proliferation or that stimulated by EGF or bFGF (IC50s = >5,000, 1,900, and 1,600 nM, respectively).Formal Name: 4-fluoro-2-methyl-5-[[7-(phenylmethoxy)-4-quinazolinyl]amino]-phenol,...
| Schlagworte: | 4-fluoro-2-methyl-5-[[7-(phenylmethoxy)-4-quinazolinyl]amino]-phenol, monohydrochloride |
| Anwendung: | VEGFR2 inhibitor |
| CAS | 193000-39-4 |
| MW: | 411.9 D |
ab 49,00 €
ZM323881 hydrochloride
Artikelnummer: TGM-T1991-10mg
Description: ZM323881 hydrochloride (ZM 323881 HCl) is a potent and selective VEGFR2 inhibitor. Target: EGFR, PDGFR, VEGFR, FGFR. Smiles: Cl.Cc1cc(F)c(Nc2ncnc3cc(OCc4ccccc4)ccc23)cc1O. References: Whittles CE, et al. Microcirculation, 2002, 9(6), 513-522.
| Schlagworte: | ZM 323881 HCl, ZM 323881 hydrochloride |
| CAS | 193000-39-4 |
| MW: | 411.86 D |
ab 62,00 €
