Zu "192703-06-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR 144528
Artikelnummer: Cay9000491-5
SR 144528 is a cannabinoid 2 (CB2) receptor antagonist (Ki = 0.6 nM). It is selective for CB2 over CB1 receptors in CHO cells expressing the human receptors (Ki = 437 nM). SR 144528 reverses CP 55,940-induced inhibition of forskolin-induced adenylyl cyclase activity in CHO cells expressing human CB2 receptors (EC50...
| Schlagworte: | SR144528,... |
| Anwendung: | CB2 antagonist |
| CAS | 192703-06-3 |
| MW: | 476.1 D |
ab 174,00 €
SR144528
Artikelnummer: LKT-S680000.1
Selective cannabinoid receptor 2 (CB2) inverse agonist.
| Schlagworte: | 5-(4-chloro-3-methylphenyl)-1-[(4-methylphenyl)methyl]-N-[(1R,3S,4S)-2,2,4-trimethyl-3-bicyclo[2.2.1]heptanyl]pyrazole-3-c... |
| Anwendung: | CB2 antagonist |
| CAS | 192703-06-3 |
| MW: | 476.06 D |
ab 169,00 €
SR144528
Artikelnummer: TGM-T16928-100mg
Description: SR144528 is an antagonist of the CB2 receptor (Ki = 0.6 nM) and inhibits microsomal ACAT activity (IC50 = 3.6 µM). Target: Cannabinoid Receptor. Smiles: [H][C@@]12CC[C@@](C)(C1)[C@H](NC(=O)c1cc(-c3ccc(Cl)c(C)c3)n(Cc3ccc(C)cc3)n1)C2(C)C. References: Rinaldi-Carmona M, et al. SR 144528, the first potent...
| Anwendung: | CB2 antagonist |
| CAS | 192703-06-3 |
| MW: | 476.05 D |
ab 35,00 €
