Zu "189453-10-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Epothilone D
Artikelnummer: Cay18765-5
Epothilones are microtubule-stabilizing agents with potential anti-neoplastic actions. They are natural macrolides that have high potency in both taxane-sensitive and taxane-resistant models. Epothilone D is a desoxy form of epothilone B (Cay-10924) that inhibits the growth of a variety of cancer cells both in vitro...
| Schlagworte: | Desoxyepothilone B, NSC 73147,... |
| Anwendung: | Microtubule-stabilizing agent, brain penetrant |
| CAS | 189453-10-9 |
| MW: | 491.7 D |
ab 122,00 €
Epothilone D
Artikelnummer: LKT-E6356.10
A synthetic analog of epothilone has shown promise as a possible treatment to slow neurological damage and improve brain function in an animal model of Alzheimer's disease.
| CAS | 189453-10-9 |
| MW: | 491.68 D |
ab 155,00 €
Epothilone D
Artikelnummer: TGM-TQ0202-100mg
Description: Epothilone D (KOS 862) is a potent microtubule stabilizer. Target: Microtubule Associated. Smiles: C[C@H]1CCC\C(C)=C/C[C@H](OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@H]1O)C(\C)=C\c1csc(C)n1. References: Konner J, et al. Phase I clinical, pharmacokinetic, and pharmacodynamic study of KOS-862 (Epothilone D)...
| Schlagworte: | KOS 862 |
| Anwendung: | Microtubule-stabilizing agent, brain penetrant |
| CAS | 189453-10-9 |
| MW: | 491.68 D |
ab 918,00 €
