Zu "189061-11-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NGB 2904 (hydrochloride)
Artikelnummer: Cay21457-1
NGB 2904 is an antagonist that is selective for the dopamine D3 receptor (Ki = 1.4 nM). It potently inhibits quinpirole-stimulated mitogenesis (IC50 = 6.8 nM). NGB 2904 attenuates cocaine- and stress-induced reinstatement of drug-seeking behavior in rats. It also increases spontaneous and amphetamine-stimulated...
| Schlagworte: | N-[4-[4-(2,3-dichlorophenyl)-1-piperazinyl]butyl]-9H-fluorene-2-carboxamide, monohydrochloride |
| Anwendung: | Dopamine D3 receptor antagonist |
| CAS | 189061-11-8 |
| MW: | 530.9 D |
ab 58,00 €
NGB 2904 hydrochloride
Artikelnummer: TGM-T23065-1mg
Description: dopamine D3 receptor antagonist. Target: Others. Smiles: Cl.O=C(NCCCCN1CCN(C=2C=CC=C(Cl)C2Cl)CC1)C3=CC=C4C=5C=CC=CC5CC4=C3
| Schlagworte: | NGB 2904 |
| Anwendung: | Dopamine D3 receptor antagonist |
| CAS | 189061-11-8 |
| MW: | 530.92 D |
ab 133,00 €
