Zu "188591-67-5" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Traxoprodil Mesylate
Traxoprodil Mesylate

Artikelnummer: TGM-TQ0233L-100mg

Description: Traxoprodil Mesylate is a potent noncompetitive N-methyl-D-aspartate (NMDA) receptors antagonist and has selective for the NR2B subunit. Target: Others. Smiles: S(C)(=O)(=O)O.OC1(CCN([C@H]([C@@H](O)C2=CC=C(O)C=C2)C)CC1)C3=CC=CC=C3. References: DePoy LM, Zimmermann KS, Marvar PJ, Gourley SL. Induction...
CAS 188591-67-5
MW: 423.52 D
ab 1.440,00 €
Bewerten