Zu "1858276-04-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Subasumstat
Artikelnummer: TGM-T8428-1mg
Description: Subasumstat (TAK-981), a selective inhibitor of the SUMOylation enzymatic cascade, has potential immune-activating and antineoplastic activities. Target: E1/E2/E3 Enzyme. Smiles: Cc1sc(cc1[C@@H]1NCCc2ccc(Cl)cc12)C(=O)c1cncnc1N[C@H]1C[C@H](O)[C@@H](COS(N)(=O)=O)C1. References: Sumoylation inhibitor TAK-981.
| Schlagworte: | TAK-981 |
| Anwendung: | Antineoplastic, Sumoylation inhibitor |
| CAS | 1858276-04-6 |
| MW: | 578.1 D |
ab 75,00 €
TAK-981
Artikelnummer: Cay32741-1
TAK-981 is an inhibitor of SUMO-activating enzyme (SAE, IC50 = in vitro. TAK-981 upregulates the expression of IFN-regulated genes in the blood and tumor tissue in an A20 syngeneic lymphoma mouse model. It also decreases intratumor levels of SUMOlyated proteins and reduces tumor growth in the same model.Formal Name:...
| Schlagworte: | [(1R,2S,4R)-4-[[5-[[4-[(1R)-7-chloro-1,2,3,4-tetrahydro-1-isoquinolinyl]-5-methyl-2-thienyl]carbonyl]-4-pyrimidinyl]amino]... |
| Anwendung: | SUMO-activating enzyme (SAE) inhibitor |
| CAS | 1858276-04-6 |
| MW: | 578.1 D |
ab 94,00 €
