Zu "184845-18-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NNC 05-2090 (hydrochloride)
Artikelnummer: Cay42491-10
NNC 05-2090 is an antagonist of betaine/GABA transporter 1 (BGT1, IC50 = 5. µM for the human transporter). It also inhibits mouse GABA transporter 1 (GAT1), mouse GAT2, mouse GAT3, rat serotonin transporter (SERT), rat noradrenaline transporter (NET), and rat dopamine transporter (DAT, IC50s = 29. 45. 22. 5. 7. and...
| Schlagworte: | 1-[3-(9H-carbazol-9-yl)propyl]-4-(2-methoxyphenyl)-4-piperidinol, monohydrochloride |
| Anwendung: | BGT1 antagonist |
| CAS | 184845-18-9 |
| MW: | 451 D |
ab 147,00 €
NNC 05-2090 hydrochloride
Artikelnummer: TGM-T23072-100mg
Description: NNC 05-2090 hydrochloride is a betaine/GABA transporter (BGT-1) inhibitor with an IC50 value of 10.6 µM.NNC 05-2090 hydrochloride can be used for the study of epilepsy and neurological disorders. Target: Transaminase. Smiles: Cl.OC1(C=2C=CC=CC2OC)CCN(CCCN3C=4C=CC=CC4C=5C=CC=CC53)CC1. References: Dalby...
| CAS | 184845-18-9 |
| MW: | 451 D |
ab 42,00 €
