Zu "1807861-48-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ONC212
Artikelnummer: Cay30931-5
ONC212 is an agonist of the orphan G protein-coupled receptor GPR132 (EC50 = ~400 nM in a PathHunter(R) beta-arrestin assay). It inhibits cell growth in a panel of 62 human leukemia cell lines, including acute myeloid leukemia (AML), acute lymphoblastic leukemia (ALL), chronic myelogenous leukemia (CML), and hairy...
| Schlagworte: | 2,4,6,7,8,9-hexahydro-7-(phenylmethyl)-4-[[4-(trifluoromethyl)phenyl]methyl]-imidazo[1,2-a]pyrido[3,4-e]pyrimidin-5(1H)-one |
| Anwendung: | GPR132 agonist |
| CAS | 1807861-48-8 |
| MW: | 440.5 D |
ab 89,00 €
ONC212
Artikelnummer: TGM-T7398-100mg
Description: ONC212 [a fluorinated-ONC201 analogue] is a selective GPR132 agonist. Target: Apoptosis, GPR. Smiles: FC(F)(F)c1ccc(CN2C3=NCCN3C3=C(CN(Cc4ccccc4)CC3)C2=O)cc1. References: Nii T, Prabhu VV, Ruvolo V,et al.Imipridone ONC212 activates orphan G protein-coupled receptor GPR132 and integrated stress response...
| Anwendung: | GPR132 agonist |
| CAS | 1807861-48-8 |
| MW: | 440.46 D |
ab 42,00 €
