Zu "1800398-38-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LXH254
Artikelnummer: Cay28231-1
LXH254 is a pan-RAF inhibitor that selectively inhibits B-RAF and C-RAF over a panel of 456 human kinases. It inhibits MAPK signaling in tumor cells expressing mutant B-RAFV600. LXH254 induces tumor regression in various mouse xenograft models.Formal Name:...
| Schlagworte: | N-[3-[2-(2-hydroxyethoxy)-6-(4-morpholinyl)-4-pyridinyl]-4-methylphenyl]-2-(trifluoromethyl)-4-pyridinecarboxamide |
| Anwendung: | pan-RAF inhibitor |
| CAS | 1800398-38-2 |
| MW: | 502.5 D |
ab 97,00 €
LXH254
Artikelnummer: TGM-T11898-100mg
Description: LXH254 is a potent C-Raf and B-Raf inhibitor. Target: Raf. Smiles: Cc1ccc(NC(=O)c2ccnc(c2)C(F)(F)F)cc1-c1cc(OCCO)nc(c1)N1CCOCC1. References: CAPONIGRO, Giordano, et al. THERAPEUTIC COMBINATIO NSCOMPRISI NGARAFINHI BITORANDAE RKINHIBITO R. WO 2018051306 A1 20180322
| Anwendung: | Targets B-Raf proto-oncogene serine/threonine-protein kinase [EC:2.7.11.1] (BRAF) |
| CAS | 1800398-38-2 |
| MW: | 502.49 D |
ab 46,00 €
LXH254
Artikelnummer: LKT-L930280.1
LXH254 is a type II RAF inhibitor. SMILES: CC1=C(C=C(C=C1)NC(=O)C2=CC(=NC=C2)C(F)(F)F)C3=CC(=NC(=C3)OCCO)N4CCOCC4
| Schlagworte: | Naporafenib,... |
| Anwendung: | pan-RAF inhibitor |
| CAS | 1800398-38-2 |
| MW: | 502.49 D |
ab 85,00 €
