Zu "179545-77-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tanomastat
Artikelnummer: Cay19258-1
Tanomastat is an inhibitor of matrix metalloproteinase-2 (MMP-2), MMP-3, and MMP-9 (Kis = 11, 143, and 301 nM, respectively). It is selective for MMP-2, -3, and -9 over MMP-1 and MMP-13 (Kis = 5,000 and 1,470 nM, respectively). Tanomastat (15 µM) inhibits VEGF- and FGF-induced tubule formation in human umbilical...
| Schlagworte: | BAY 12-9566, 4'-chloro-gamma-oxo-alphaS-[(phenylthio)methyl]-[1,1'-biphenyl]-4-butanoic acid |
| Anwendung: | MMP2 / MMP3 / MMP9 inhibitor |
| CAS | 179545-77-8 |
| MW: | 410.9 D |
ab 54,00 €
Tanomastat
Artikelnummer: TGM-T16986-10mg
Description: Tanomastat is an orally bioavailable and non-peptidic biphenyl matrix metalloproteinases inhibitor. For MMP-2, MMP-3, MMP-9, MMP-13 the Ki values are 11, 143, 301, and 1470 nM respectively. Target: MMP. Smiles: C(C[C@H](CSC1=CC=CC=C1)C(O)=O)(=O)C2=CC=C(C=C2)C3=CC=C(Cl)C=C3. References: Leung D, et al....
| Schlagworte: | BAY 12-9566 |
| Anwendung: | Targets matrix metalloproteinase-1 (interstitial collagenase) [EC:3.4.24.7] (MMP1) |
| CAS | 179545-77-8 |
| MW: | 410.91 D |
ab 83,00 €
