Zu "17878-69-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
O-methyl Sterigmatocystin
Artikelnummer: Cay22070-1
O-methyl Sterigmatocystin (OMST) is a xanthone found in several fungal species including A. flavus, A. parasiticus, A. versicolor, and B. piluliferum. It is a carcinogenic precursor of aflatoxin G1 (Cay-11295) and aflatoxin B1 (Cay-11293) that is a known contaminant of agricultural soils. OMST is cytotoxic against...
| Schlagworte: | OMST, 3aR,12cS-dihydro-6,8-dimethoxy-7H-furo[3',2':4,5]furo[2,3-c]xanthen-7-one |
| Anwendung: | Cytotoxic agent |
| CAS | 17878-69-2 |
| MW: | 338.3 D |
ab 173,00 €
O-Methylsterigmatocystin
Artikelnummer: TGM-T81608-1mg
Description: O-Methylsterigmatocystin is a metabolite produced by Aspergillus flavus and Aspergillus parasiticus [1]. Smiles: [H][C@]12OC=C[C@@]1([H])c1c(O2)cc(OC)c2c1oc1cccc(OC)c1c2=O
| CAS | 17878-69-2 |
| MW: | 338.31 D |
ab 264,00 €
O-Methylsterigmatocystin
Artikelnummer: M3388-25.1
O-Methylsterigmatocystin is a xanthone isolated from several species of Aspergillus and Chaetomium. O-Methysterigmatocystin is structurally related to the aflatoxins and while the available data has led it to be considered mutagenic, teratogenic and carcinogenic, it is less widespread and potent than the aflatoxins....
| CAS | 17878-69-2 |
| MW: | 338,3 D |
412,00 €
