Zu "177583-70-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
ZK 164015
Artikelnummer: Cay45945-1
ZK 164015 is an estrogen receptor antagonist (IC50 = 25 nM in a reporter assay). It inhibits the proliferation of MCF-7 breast cancer cells stimulated with E2 (17beta-estradiol, IC50 = 51 nM) and unstimulated MCF-7 cells (IC50 = 1.4 nM). ZK 164015 does not increase uterine weight in mice. It also inhibits the growth...
| Schlagworte: | 2-(4-hydroxyphenyl)-3-methyl-1-[10-(pentylsulfonyl)decyl]-1H-indol-5-ol |
| Anwendung: | Estrogen receptor antagonist |
| CAS | 177583-70-9 |
| MW: | 513.74 D |
ab 68,00 €
ZK 164015
Artikelnummer: TGM-T23561-100mg
Description: estrogen receptor silent antagonist. Target: Others. Smiles: C(CCCCCCCCCS(CCCCC)(=O)=O)N1C(=C(C)C=2C1=CC=C(O)C2)C3=CC=C(O)C=C3
| CAS | 177583-70-9 |
| MW: | 513.73 D |
ab 1.440,00 €
