Zu "17735-94-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Paullinic acid
Artikelnummer: TGM-T19504-1mg
Description: Paullinic acid (cis-13-eicosenoic acid) is a long-chain fatty acid extracted from Tinospora crispa. Target: Endogenous Metabolite. Smiles: C(CCCC/C=C\CCCCCC)CCCCCCC(O)=O
| Schlagworte: | cis-13-eicosenoic acid |
| CAS | 17735-94-3 |
| MW: | 310.51 D |
ab 73,00 €
13(Z)-Eicosenoic Acid
Artikelnummer: Cay26169-10
13(Z)-Eicosenoic acid is an omega-7 fatty acid found in a variety of fish from the Indian, Atlantic, and Pacific oceans. It increases triglyceride accumulation in 3T3-L1 cells when used at a concentration of 50 µM.CAS Number: 17735-94-3. Synonyms: C20:1(13Z), C20:1 n-7, cis-13-Eicosenoic Acid, FA 20:1, Paullinic...
| Schlagworte: | cis-13-Eicosenoic Acid, C20:1 n-7, C20:1(13Z), Paullinic Acid |
| Anwendung: | omega-7 fatty acid |
| CAS | 17735-94-3 |
| MW: | 310.5 D |
ab 49,00 €
