Zu "177158-21-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-nonanoyl-L-Homoserine lactone
Artikelnummer: Cay16868-5
N-nonanoyl-L-Homoserine lactone is an N-acylated homoserine lactone and a bacterial quorum-sensing signaling molecule. It induces GFP production in an E. coli reporter strain expressing the V. fischeri LuxR-PluxI quorum-sensing operon when used at concentrations ranging from 100 to 1,000 nM.Formal Name:...
| Schlagworte: | C9-HSL, N-[(3S)-tetrahydro-2-oxo-3-furanyl]-nonanamide |
| Anwendung: | Bioactive lipid assays |
| CAS | 177158-21-3 |
| MW: | 241.3 D |
ab 69,00 €
N-Nonanoyl-L-homoserine lactone
Artikelnummer: CDX-N0236-M010
Source/Host Chemicals: Synthetic. Appearance: White to off-white solid. Solubility: Soluble in DMSO or DMF (20mg/ml). Identity: Determined by 1H-NMR. InChi Key: OMPXHNXRUVEQDO-NSHDSACASA-N Smiles: O=C1[C@@H](NC(CCCCCCCC)=O)CCO1 N-Nonanoyl-L-homoserine lactone is a small diffusible signaling molecule involved in...
| Schlagworte: | C9-L-HSL |
| Anwendung: | Quorum sensing |
| CAS | 177158-21-3 |
| MW: | 241.33 D |
ab 73,00 €
