Zu "176977-56-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LY320135
Artikelnummer: Cay11738-1
LY320135 is a selective cannabinoid (CB) receptor 1 antagonist (Kis = 224 and >10,000 nM for CB1 and CB2, respectively, in vitro). It is selective for CB1 over alpha1- and alpha2- adrenergic, D1 and D2 dopamine, benzodiazepine, histamine H1, GABA, serotonin (5-HT), and muscarinic receptors. It reverses the...
| Schlagworte: | 4-[[6-methoxy-2-(4-methoxyphenyl)-3-benzofuranyl]carbonyl]-benzonitrile |
| Anwendung: | Cannabinoid receptor 1 (CB1) antagonist |
| CAS | 176977-56-3 |
| MW: | 383.4 D |
ab 44,00 €
LY320135
Artikelnummer: TGM-T22951-10mg
Description: CB1 receptor antagonist/inverse agonist. Target: Others. Smiles: C(=O)(C1=C(OC=2C1=CC=C(OC)C2)C3=CC=C(OC)C=C3)C4=CC=C(C#N)C=C4
| Schlagworte: | LY 320135 |
| CAS | 176977-56-3 |
| MW: | 383.4 D |
ab 341,00 €
