Zu "175673-57-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(-)-Volinanserin
Artikelnummer: Cay42955-1
(-)-Volinanserin is an antagonist of the serotonin (5-HT) receptor subtype 5-HT2A (IC50 = 15. nM). It is selective for 5-HT2A over the 5-HT2C, dopamine D2, and alpha1-adrenergic receptors (IC50s = 750, >10,000, and 1,000 nM, respectively).. Solulibility: Ethanol: Soluble: =10 mg/ml: .
| Schlagworte: | (-)-M100907, (-)-MDL 100907, (S)-MDL 100907, aS-(2,3-dimethoxyphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-piperidinemethanol |
| Anwendung: | 5-HT2A receptor antagonist |
| CAS | 175673-57-1 |
| MW: | 373.47 D |
ab 116,00 €
MDL 100009
Artikelnummer: TGM-T22359-100mg
Description: MDL 100009, the S-enantiomer of MDL 100151 and the opposite enantiomer of MDL 100907, is a selective antagonist of 5-HT2A. Target: 5-HT Receptor. Smiles: [C@@H](O)(C1=C(OC)C(OC)=CC=C1)C2CCN(CCC3=CC=C(F)C=C3)CC2
| CAS | 175673-57-1 |
| MW: | 373.46 D |
ab 100,00 €
