Zu "174636-32-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Talnetant
Artikelnummer: TGM-T7549-100mg
Description: Talnetant (SB 223412) is a selective, competitive NK3 receptor antagonist that penetrates the brain and modulates mesolimbic and mesocortical dopaminergic neurotransmission. Target: Neurokinin receptor. Smiles: CC[C@H](NC(=O)c1c(O)c(nc2ccccc12)-c1ccccc1)c1ccccc1. References: Dawson L A , Cato K J ,...
| Schlagworte: | SB 223412 |
| Anwendung: | Tachykinin receptor 3 antagonist |
| CAS | 174636-32-9 |
| MW: | 382.45 D |
ab 37,00 €
Talnetant
Artikelnummer: Cay29699-100
Talnetant is an antagonist of the neurokinin-3 (NK3) receptor (Ki = 1 nM). It is selective for NK3 over NK1 and NK2 receptors (Kis = 144 and >100,000 nM, respectively, in CHO cells expressing recombinant human receptors). Talnetant inhibits calcium mobilization induced by neurokinin B (Cay-24542) in HEK293 cells...
| Schlagworte: | SB-223412, 3-hydroxy-2-phenyl-N-[(1S)-1-phenylpropyl]-4-quinolinecarboxamide |
| Anwendung: | Tachykinin receptor 3 antagonist |
| CAS | 174636-32-9 |
| MW: | 382.5 D |
ab 111,00 €
