Zu "174605-64-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
L-742001 Hydrochloride
Artikelnummer: TGM-T25590-100mg
Description: L-742001 Hydrochloride is an RNA polymerase inhibitor. Target: Others. Smiles: Cl.OC(=O)C(\O)=C\C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1. References: Yan Z, Zhang L, Fu H, Wang Z, Lin J. Design of the influenza virus inhibitors targeting the PA endonuclease using 3D-QSAR modeling, side-chain hopping, and...
| Schlagworte: | L742001 Hydrochloride, L-742001, L742001, L 742001 |
| Anwendung: | Influenza PA endonuclease inhibitor |
| CAS | 174605-64-2 |
| MW: | 450.36 D |
ab 1.820,00 €
L-742,001 (hydrochloride)
Artikelnummer: Cay40920-1
L-742,001 is an inhibitor of influenza virus PA endonuclease (IC50 = 0.5 µM), an essential subdomain of the viral RNA polymerase. It reduces viral titers in PR8 influenza-infected MDCK cells when used at a concentration of 10 µM.Formal Name:...
| Schlagworte: | 4-[4-[(4-chlorophenyl)methyl]-1-(phenylmethyl)-4-piperidinyl]-2-hydroxy-4-oxo-2-butenoic acid, monohydrochloride |
| Anwendung: | Influenza PA endonuclease inhibitor |
| CAS | 174605-64-2 |
| MW: | 450.4 D |
ab 67,00 €
