Zu "171486-59-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
2'-O-Propargyl A(Bz)-3'-Phosphoramidite
Artikelnummer: Cay43628-10
2'-O-Propargyl A(Bz)-3'-phosphoramidite is a nucleoside building block that has been used in the synthesis of propargylated ribonucleosides for DNA crosslinking. SMILES O=C(C1=CC=CC=C1)NC2=C(N=C3)C(N3[C@H]4[C@H](OCC#C)[C@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](COC(C5=CC=C(OC)C=C5)(C6=CC=C(OC)C=C6)C7=CC=CC=C7)O4)=NC=N2...
| Schlagworte: | 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphor amidite],... |
| Anwendung: | Nucleoside building block |
| CAS | 171486-59-2 |
| MW: | 912 D |
ab 40,00 €
2'-O-Propargyl A(Bz)-3'-phosphoramidite
Artikelnummer: TGM-TNU0937-100mg
Description: 2'-O-Propargyl A(Bz)-3'-phosphoramidite is a 2'-modified nucleoside phosphoramidite derivative. Target: Others. Smiles: C(OC[C@@H]1[C@@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@@H](OCC#C)[C@@H](O1)N2C=3C(N=C2)=C(NC(=O)C4=CC=CC=C4)N=CN3)(C5=CC=C(OC)C=C5)(C6=CC=C(OC)C=C6)C7=CC=CC=C7
| CAS | 171486-59-2 |
| MW: | 911.98 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
