Zu "171263-26-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Palmitoyl hexapeptide-12
Artikelnummer: TGM-T81566-50mg
Description: Palmitoyl hexapeptide-12, a bioactive peptide recognized for its anti-aging properties, is utilized as an ingredient in cosmetics [1]. Smiles: CCCCCCCCCC CCCCCC(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)NCC(O)=O
| CAS | 171263-26-6 |
| MW: | 736.98 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Palmitoyl Hexapeptide-12
Artikelnummer: CSB-DT1702.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Pal-Val-Gly-Val-Ala-Pro-Gly, Pal-VGVAPG |
| Anwendung: | Cosmetic peptide |
| CAS | 171263-26-6 |
| MW: | 736.993 D |
248,00 €
