Zu "171228-49-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Posaconazole
Artikelnummer: TGM-T6211-100mg
Description: Posaconazole (POS) is a sterol C14alpha demethylase inhibitor (IC50: 0.25 nM). Target: Antifungal. Smiles: C([C@@]1(C[C@H](COC2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)N5C(=O)N([C@H]([C@H](C)O)CC)N=C5)CO1)C6=C(F)C=C(F)C=C6)N7C=NC=N7. References: Benaim G, et al. J Med Chem. 2006, 49(3), 892-389.
| Schlagworte: | SCH 56592, POS |
| Anwendung: | Targets sterol 14alpha-demethylase [EC:1.14.14.154 1.14.15.36] (CYP51) |
| CAS | 171228-49-2 |
| MW: | 700.78 D |
ab 40,00 €
Posaconazole
Artikelnummer: Cay14737-10
Posaconazole is a broad-spectrum triazole antifungal agent active against various yeasts and molds, including Aspergillus, Candida, Fusarium, and Zygomycetes. Posaconazole inhibits the growth of fungi by inhibiting the lanosterol 14alpha-demethylase enzyme (IC50s = 7-200 nM), which results in a disruption in the...
| Schlagworte: | POS, SCH 56592,... |
| Anwendung: | Antifungal, lanosterol 14a-demethylase inhibitor |
| CAS | 171228-49-2 |
| MW: | 700.8 D |
ab 83,00 €
