Zu "170911-68-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Donitriptan (hydrochloride)
Artikelnummer: Cay44116-1
Donitriptan is an agonist of the serotonin (5-HT) receptor subtypes 5-HT1B and 5-HT1D. It inhibits forskolin-induced cAMP formation in C6 cells expressing the human receptors (pD2 = 8.91 and 9.57, respectively). Donitriptan is selective for 5-HT1B and 5-HT1D (Kis = 0.36 and 0.15 nM, respectively, for the human...
| Schlagworte: | F 11356, 4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]-1-piperazinyl]-benzonitrile, monohydrochloride |
| Anwendung: | 5-HT1B / 5-HT1D agonist |
| CAS | 170911-68-9 |
| MW: | 439,94 D |
ab 54,00 €
Donitriptan hydrochloride
Artikelnummer: TGM-T21666-100mg
Description: Donitriptan hydrochloride (Donitriptan monohydrochloride) is a potent, high efficacy agonist of 5-HT1B/1D receptors with pKis of 9.4 and 9.3, respectively. Target: 5-HT Receptor. Smiles: Cl.N#CC1=CC=C(C=C1)N2CCN(C(=O)COC=3C=CC=4NC=C(C4C3)CCN)CC2. References: Muñoz-Islas E, et al. Donitriptan, but not...
| Schlagworte: | Donitriptan monohydrochloride, Donitriptan HCl |
| CAS | 170911-68-9 |
| MW: | 439.94 D |
ab 33,00 €
